| Company Name: |
Shanghai wechem chemical co., ltd Gold
|
| Tel: |
18824865657 |
| Email: |
2684615189@qq.com |
| Products Intro: |
Product Name:Ammonium nitrate-15N
CAS:31432-46-9
Purity:99% HPLC Package:100g;500g;1kg
|
| Company Name: |
Wuhan eastop Technology Co., ltd.6 Gold
|
| Tel: |
18086015167 17702779303 |
| Email: |
service@isotopechina.com |
| Products Intro: |
Product Name:AMMONIUM NITRATE(NITRATE-15N, 98%+)
CAS:31432-46-9
Purity:99% Package:1g
|
|
| | AMMONIUM NITRATE-15N Basic information |
| | AMMONIUM NITRATE-15N Chemical Properties |
| Melting point | 169 °C (lit.) | | Boiling point | 210 °C (lit.) | | form | solid | | InChI | InChI=1S/HNO3.H3N/c2-1(3)4;/h(H,2,3,4);1H3/i1+1; | | InChIKey | PRORZGWHZXZQMV-YTBWXGASSA-N | | SMILES | [15N+]([O-])(=O)O.N | | CAS Number Unlabeled | 6484-52-2 |
| Hazard Codes | O,Xi | | Risk Statements | 8-36/37/38 | | Safety Statements | 17-26-36 | | RIDADR | UN 1942 5.1/PG 3 | | WGK Germany | 3 | | HS Code | 28459000 | | Storage Class | 5.1C - Ammonium nitrate and ammonium nitrate containing preparations | | Hazard Classifications | Eye Irrit. 2
Ox. Sol. 3 |
| | AMMONIUM NITRATE-15N Usage And Synthesis |
| Chemical Properties | Solid | | Uses | Ammonium nitrate-15N is a commonly used compound in agriculture research as a tracer. | | Uses | AMMONIUM NITRATE-15N is an commonly used compound in agriculture as high-nitrogen fertilizer and has also been used as an oxidizing agent in improvised explosive devices. | | General Description | Ammonium nitrate-15N is an inorganic salt containing 15N isotope |
| | AMMONIUM NITRATE-15N Preparation Products And Raw materials |
|