| Company Name: |
Tcichem, Inc. Gold
|
| Tel: |
13918644899 |
| Email: |
81587635@qq.com |
| Products Intro: |
Product Name:methyl 3-(2-aminothiazol-4-yl)propanoate CAS:398472-21-4 Purity:95% HPLC Package:1G;5G;10G;25G;50G;100G;1KG
|
| Company Name: |
Changzhou Hopschain Chemical Co.,Ltd.
|
| Tel: |
85528066 13775048983 |
| Email: |
sales@hopschem.com |
| Products Intro: |
Product Name:methyl 3-(2-amino-1,3-thiazol-4-yl)propanoate CAS:398472-21-4 Purity:95+% Package:100mg;250mg;500mg;1g;2.5g;5g;10g
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58851090 19370895928 |
| Email: |
2850281427@qq.com |
| Products Intro: |
Product Name:Methyl 3-(2-amino-1,3-thiazol-4-yl)propanoate CAS:398472-21-4 Purity:95%+ Package:1g;5g;10g
|
|
| | methyl 3-(2-aminothiazol-4-yl)propanoate Basic information |
| | methyl 3-(2-aminothiazol-4-yl)propanoate Chemical Properties |
| InChI | InChI=1S/C7H10N2O2S/c1-11-6(10)3-2-5-4-12-7(8)9-5/h4H,2-3H2,1H3,(H2,8,9) | | InChIKey | JWDGXHZFNYKFGE-UHFFFAOYSA-N | | SMILES | S1C=C(CCC(OC)=O)N=C1N |
| | methyl 3-(2-aminothiazol-4-yl)propanoate Usage And Synthesis |
| | methyl 3-(2-aminothiazol-4-yl)propanoate Preparation Products And Raw materials |
|