2,4-DIMETHYL-1,3-PENTADIENE manufacturers
|
| | 2,4-DIMETHYL-1,3-PENTADIENE Basic information |
| Product Name: | 2,4-DIMETHYL-1,3-PENTADIENE | | Synonyms: | 2,4-DIMETHYL-1,3-PENTADIENE;1,1,3-Trimethylbutadiene;1,3-pentadiene,2,4-dimethyl-;2,4-dimethyl-penta-1,3-diene;2,4-dimethylpenta-2,4-diene;2,4-DIMETHYL-1,3-PENTADIENE, 98+%;2,4-DIMETHYL-1,3-PENTADIENE 98%;1,1,3-Trimethyl-1,3-butadiene | | CAS: | 1000-86-8 | | MF: | C7H12 | | MW: | 96.17 | | EINECS: | 213-677-4 | | Product Categories: | Acyclic;Alkenes;Organic Building Blocks;Building Blocks;Chemical Synthesis;Organic Building Blocks | | Mol File: | 1000-86-8.mol |  |
| | 2,4-DIMETHYL-1,3-PENTADIENE Chemical Properties |
| Melting point | -114℃ | | Boiling point | 94 °C (lit.) | | density | 0.744 g/mL at 25 °C (lit.) | | vapor pressure | 67 mm Hg ( 37.7 °C) | | refractive index | n20/D 1.441(lit.) | | Fp | 50 °F | | storage temp. | Flammables area | | form | Liquid | | color | Clear colorless to light yellow | | InChI | InChI=1S/C7H12/c1-6(2)5-7(3)4/h5H,1H2,2-4H3 | | InChIKey | CMSUNVGIWAFNBG-UHFFFAOYSA-N | | SMILES | C=C(C)/C=C(\C)/C | | CAS DataBase Reference | 1000-86-8 |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-36/37/39 | | RIDADR | UN 3295 3/PG 2 | | WGK Germany | 3 | | HazardClass | 3.1 | | PackingGroup | II | | HS Code | 29012900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,4-DIMETHYL-1,3-PENTADIENE Usage And Synthesis |
| Chemical Properties | CLEAR COLORLESS TO LIGHT YELLOW LIQUID | | Uses | 2,4-Dimethyl-1,3-pentadiene has been used to study the structure of its various conformational isomers and their vibrational spectra. |
| | 2,4-DIMETHYL-1,3-PENTADIENE Preparation Products And Raw materials |
| Raw materials | 3,3,5,5-tetramethyllimonene-->2-Pentene, 4-chloro-2,4-dimethyl--->3-bromo-1,1,2,2-tetramethylcyclopropane-->3-Penten-2-ol, 2,4-dimethyl--->TETRAMETHYLALLENE-->2,4-DIMETHYL-2-PENTENE-->2,4-Dimethyl-3-pentanone-->Trimethylphosphine-->Methanol-->Trifluoromethanesulfonic acid-->Triethylamine-->Mesityl oxide |
|