- Boc-Cys(Mbzl)-OH
-
-
2026-06-05
- CAS:61925-77-7
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
|
| | Boc-S-(4-methylbenzyl)-L-cysteine Basic information |
| | Boc-S-(4-methylbenzyl)-L-cysteine Chemical Properties |
| Melting point | 63-66 °C | | alpha | -34 º (c=2 in methanol) | | Boiling point | 493.8±45.0 °C(Predicted) | | density | 1.181±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.57±0.10(Predicted) | | Optical Rotation | [α]/D -34.0±3.0°, c = 2 in methanol | | BRN | 3594717 | | Major Application | peptide synthesis | | InChI | 1S/C16H23NO4S/c1-11-5-7-12(8-6-11)9-22-10-13(14(18)19)17-15(20)21-16(2,3)4/h5-8,13H,9-10H2,1-4H3,(H,17,20)(H,18,19) | | InChIKey | CUNVVZWSABRKAL-UHFFFAOYSA-N | | SMILES | S(CC(NC(=O)OC(C)(C)C)C(=O)O)Cc1ccc(cc1)C | | CAS DataBase Reference | 61925-77-7(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2930 90 16 | | Storage Class | 11 - Combustible Solids |
| | Boc-S-(4-methylbenzyl)-L-cysteine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Boc-L-Cys(pMeBzl)-OH, is a Cystine derivative, used in various chemical synthesis and peptide chemistry. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-S-(4-methylbenzyl)-L-cysteine Preparation Products And Raw materials |
|