18BETA(H)-OLEAN-12-EN-3-ONE manufacturers
- beta-Amyrone
-
- $122.00
-
2026-05-11
- CAS:638-97-1
- Purity: 99.95%
- Supply Ability: 10g
|
| | 18BETA(H)-OLEAN-12-EN-3-ONE Basic information |
| Product Name: | 18BETA(H)-OLEAN-12-EN-3-ONE | | Synonyms: | 18BETA(H)-OLEAN-12-EN-3-ONE;Olean-12-en-3-one;beta-Amyrone;18(H)-Olean-12-en-3-one;(6aR,6bS,8aR,12aS,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-2,4a,5,6,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picen-3-one;β-Amyron;antifungal,AChE,COX-2,PI3K-Akt,Anti-inflammatory,Fungal,β-Amyrone,inflammation,CHIKV,Cyclooxygenase,inhibit,Inhibitor,infection,obesity,Peroxisome proliferator-activated receptors,COX,PPAR;(4aR,6aR,6bS,8aR,12aR,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-Octamethyl-1,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-octadecahydropicen-3(2H)-one | | CAS: | 638-97-1 | | MF: | C30H48O | | MW: | 424.7 | | EINECS: | | | Product Categories: | | | Mol File: | 638-97-1.mol |  |
| | 18BETA(H)-OLEAN-12-EN-3-ONE Chemical Properties |
| Melting point | 177-178 °C | | Boiling point | 488.3±45.0 °C(Predicted) | | density | 1.01±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Solid | | color | White to off-white | | InChIKey | LIIFBMGUDSHTOU-CFYIDONUSA-N | | SMILES | C1(=O)[C@@]([C@]2([C@](C)(CC1)[C@]1([H])[C@@]([C@]3(C(=CC1)[C@]1([C@@](CC[C@](C1)(C)C)(C)CC3)[H])C)(C)CC2)[H])(C)C |
| | 18BETA(H)-OLEAN-12-EN-3-ONE Usage And Synthesis |
| Uses | β-Amyron is used as inhibitor of cyclooxygenase and lipoxygenase enzymes to study the structure-activity relationships of pentacyclic triterpenoids. | | in vivo | β-Amyrone (local administration on ear, 0.1-0.6 mg/kg, a single dose) inhibits ear edema formation in phenol-induced edema mice[1]. | Animal Model: | Ear phenol-induced edema in Balb C mice[1] | | Dosage: | 0.1, 0.3, 0.6 mg/kg, a single dose | | Administration: | Local administration (20 L solution) on ear | | Result: | Inhibited ear edema formation in a dose-related manner (47% inhibition at the dose of 0.6mg/kg). |
| | IC 50 | COX-2 |
| | 18BETA(H)-OLEAN-12-EN-3-ONE Preparation Products And Raw materials |
|