|
|
| | 3-BROMOPHENACYL BROMIDE Basic information |
| Product Name: | 3-BROMOPHENACYL BROMIDE | | Synonyms: | M-BROMOPHENACYL BROMIDE;BUTTPARK 41\03-59;A,3'-DIBROMOACETOPHENONE;A,3-DIBROMOACETOPHENONE;AKOS BBS-00000935;ALPHA,3'-DIBROMOACETOPHENONE;3-BROMOPHENACYL BROMIDE;3'-BROMOPHENACYLBROMIDE | | CAS: | 18523-22-3 | | MF: | C8H6Br2O | | MW: | 277.94 | | EINECS: | | | Product Categories: | | | Mol File: | 18523-22-3.mol |  |
| | 3-BROMOPHENACYL BROMIDE Chemical Properties |
| Melting point | 47-52 °C(lit.) | | Boiling point | 154-159 °C(Press: 10 Torr) | | density | 1.848±0.06 g/cm3(Predicted) | | Fp | >110℃ | | storage temp. | Keep Cold | | solubility | DMSO (Slightly) | | form | Solid | | color | Off-White | | Water Solubility | Insoluble in water. | | Sensitive | Lachrymatory | | BRN | 775786 | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C8H6Br2O/c9-5-8(11)6-2-1-3-7(10)4-6/h1-4H,5H2 | | InChIKey | MZBXSQBQPJWECM-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=CC(Br)=C1)CBr | | CAS DataBase Reference | 18523-22-3(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Lachrymatory/Keep Cold | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29147000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3-BROMOPHENACYL BROMIDE Usage And Synthesis |
| Chemical Properties | light yellow crystalline powder | | Uses | 3-Bromophenacyl bromide is a useful intermediate for pharmaceutical and organic synthesis. | | Uses | It is employed as an intermediate for pharmaceutical and organic synthesis. |
| | 3-BROMOPHENACYL BROMIDE Preparation Products And Raw materials |
|