- 5-NORBORNENE-2-OL
-
-
2026-05-27
- CAS:13080-90-5
- Min. Order: 1KG
- Purity: 98%; sales036@researchvip.com;18903931628;
- Supply Ability: 1000KG
- 5-NORBORNENE-2-OL
-
-
2026-03-20
- CAS:13080-90-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 mt
|
| | 5-Norbornene-2-ol Basic information |
| | 5-Norbornene-2-ol Chemical Properties |
| Melting point | 104-106 °C(lit.) | | Boiling point | 183.7±19.0 °C(Predicted) | | density | 1.153±0.06 g/cm3(Predicted) | | Fp | 123 °F | | storage temp. | 2-8°C | | form | solid | | pka | 14.85±0.20(Predicted) | | Appearance | Off-white to light yellow Solid | | Water Solubility | Slightly soluble in water | | InChI | InChI=1S/C7H10O/c8-7-4-5-1-2-6(7)3-5/h1-2,5-8H,3-4H2 | | InChIKey | MKOSBHNWXFSHSW-GFCOJPQKSA-N | | SMILES | C12CC(C=C1)CC2O | | CAS DataBase Reference | 13080-90-5(CAS DataBase Reference) |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 16-27-33-36/37/39 | | RIDADR | UN 1325 4.1/PG 3 | | WGK Germany | 3 | | HazardClass | 4.1 | | PackingGroup | III | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Flam. Sol. 1 |
| | 5-Norbornene-2-ol Usage And Synthesis |
| Uses |
5-Norbornene-2-ol is applied in High Performance Liquid Chromatography. (HPLC) and Nuclear Magnetic Resonance (NMR).
|
| | 5-Norbornene-2-ol Preparation Products And Raw materials |
|