|
|
| | 2-CYANO-4-PYRIDINE CARBOXYLIC ACID Basic information |
| | 2-CYANO-4-PYRIDINE CARBOXYLIC ACID Chemical Properties |
| Melting point | 335 °C | | Boiling point | 478.4±30.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 2.81±0.10(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C7H4N2O2/c8-4-6-3-5(7(10)11)1-2-9-6/h1-3H,(H,10,11) | | InChIKey | MPSVJNPESHZCIB-UHFFFAOYSA-N | | SMILES | C1(C#N)=NC=CC(C(O)=O)=C1 | | CAS DataBase Reference | 161233-97-2 |
| Hazard Codes | Xn | | Risk Statements | 22 | | HS Code | 2933399990 |
| | 2-CYANO-4-PYRIDINE CARBOXYLIC ACID Usage And Synthesis |
| Chemical Properties | off-white solid | | Uses | 2-Cyano-4-pyridine carboxylic acid can be used to synthesize a variety of compounds, including benzylisocyanate, thionyl chloride, and chloroformate. |
| | 2-CYANO-4-PYRIDINE CARBOXYLIC ACID Preparation Products And Raw materials |
|