| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Morpholine-d8
CAS:342611-02-3
Package:250Mg,25Mg
|
|
| | MORPHOLINE-2,2,3,3,5,5,6,6-D8 Basic information |
| Product Name: | MORPHOLINE-2,2,3,3,5,5,6,6-D8 | | Synonyms: | MORPHOLINE-2,2,3,3,5,5,6,6-D8;2,2,3,3,5,5,6,6-octadeuteriomorpholine;D8-Morpholine;[2H8]-Morpholine;(2,2,3,3,5,5,6,6-2H8)Morpholine;Morpholine-2,2,3,3,5,5,6,6-d8;Morpholine-2,2,3,3,5,5,6,6-D? (D, 98%);Morpholine-2,2,3,3,5,5,6,6-d8 (D, 99%) | | CAS: | 342611-02-3 | | MF: | C4HD8NO | | MW: | 95.17 | | EINECS: | | | Product Categories: | | | Mol File: | 342611-02-3.mol |  |
| | MORPHOLINE-2,2,3,3,5,5,6,6-D8 Chemical Properties |
| Boiling point | 126-130°C | | density | 1.086g/mL at 25°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Stability: | Volatile | | InChI | 1S/C4H9NO/c1-3-6-4-2-5-1/h5H,1-4H2/i1D2,2D2,3D2,4D2 | | InChIKey | YNAVUWVOSKDBBP-SVYQBANQSA-N | | SMILES | [2H]C1([2H])NC([2H])([2H])C([2H])([2H])OC1([2H])[2H] | | CAS Number Unlabeled | 110-91-8 |
| WGK Germany | WGK 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Dam. 1
Flam. Liq. 3
Skin Corr. 1B |
| | MORPHOLINE-2,2,3,3,5,5,6,6-D8 Usage And Synthesis |
| Uses | Labelled Morpholine. Morpholines compounds used as selective inhibitors of cytochrome p450 2a13 in treatment of cancer. Salicylate as analgesic; antipyretic; anti-inflammatory. |
| | MORPHOLINE-2,2,3,3,5,5,6,6-D8 Preparation Products And Raw materials |
|