|
|
| | 4,5-DIFLUORO-2-METHOXYBENZALDEHYDE Basic information |
| | 4,5-DIFLUORO-2-METHOXYBENZALDEHYDE Chemical Properties |
| Melting point | 93-97°C | | Boiling point | 239.2±35.0 °C(Predicted) | | density | 1.289±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | Light yellow to yellow Solid | | Sensitive | Air & Light Sensitive | | InChI | InChI=1S/C8H6F2O2/c1-12-8-3-7(10)6(9)2-5(8)4-11/h2-4H,1H3 | | InChIKey | ZCLXUHQRYFUSLE-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(F)=C(F)C=C1OC | | CAS DataBase Reference | 145742-34-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2913000090 |
| | 4,5-DIFLUORO-2-METHOXYBENZALDEHYDE Usage And Synthesis |
| | 4,5-DIFLUORO-2-METHOXYBENZALDEHYDE Preparation Products And Raw materials |
|