PERYLENE-D12 manufacturers
- Perylene-D12
-
-
2026-05-11
- CAS:1520-96-3
- Purity:
- Supply Ability: 10g
|
| | PERYLENE-D12 Basic information |
| | PERYLENE-D12 Chemical Properties |
| Melting point | 277-279 °C(lit.) | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly, Heated, Sonicated), Dichloromethane (Slightly, Heated) | | form | Solid | | color | Yellow to Dark Yellow | | Major Application | electronics | | InChI | 1S/C20H12/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17/h1-12H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D | | InChIKey | CSHWQDPOILHKBI-AQZSQYOVSA-N | | SMILES | [2H]c1c([2H])c2c([2H])c([2H])c([2H])c3c4c([2H])c([2H])c([2H])c5c([2H])c([2H])c([2H])c(c(c1[2H])c23)c45 | | CAS DataBase Reference | 1520-96-3 | | EPA Substance Registry System | Perylene-d12 (1520-96-3) |
| Hazard Codes | Xn | | Risk Statements | 40-67-36/37/38 | | Safety Statements | 36/37-24/25-23 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 11 - Combustible Solids |
| | PERYLENE-D12 Usage And Synthesis |
| Uses | Perylene-d12 is deuterium labelled Perylene (P291302). Perylene has been used as an acceptor for pristine C70 to be used as a sensitizer for efficient triplet-triplet annihilation upconversion; which has shown improved stability under continuous laser irradiation compared to the benchmark Pt(II)-ocetaethylprphyrin. Perylene has also been used as a dopant representing blue fluorescent dye on a white-emitting polymer film. | | Uses | May be used as an analytical standard |
| | PERYLENE-D12 Preparation Products And Raw materials |
|