- DMT-dU-CE
-
-
2024-08-08
- CAS:109389-30-2
- Min. Order: 100mg
- Purity: ≥99%
- Supply Ability: 20tons
|
| | DMT-dU-CE Phosphoramidite Basic information |
| Product Name: | DMT-dU-CE Phosphoramidite | | Synonyms: | dU Phosphoramidite;5'-O-DMT-2'-deoxyuridine-3'-CE-Phosphoramidite;5'-O-DMT- 2'-Deoxy Uridine Phosphoramidite;DMT-DU AMIDITE 0.25G, AB, SINGLE;deoxyuridine-ce phosphoramidite*for cyclone;DMT-DU AMIDITE 0.25G 89 SINGLE;DMT-DURIDINE CYANOETHYL PHOSPHORAMIDITE);N-blocked-5'-O-DMT 3'-CED deoxyuridine phosphoramidite | | CAS: | 109389-30-2 | | MF: | C39H47N4O8P | | MW: | 730.79 | | EINECS: | | | Product Categories: | Phosphoramidite | | Mol File: | 109389-30-2.mol |  |
| | DMT-dU-CE Phosphoramidite Chemical Properties |
| storage temp. | 4°C, protect from light | | solubility | DMSO : 100 mg/mL (136.84 mM) | | pka | 9.39±0.10(Predicted) | | form | Solid | | color | White to off-white | | Appearance | white to pale yellow powder | | InChIKey | ZGJUDTLSWZPIDW-KLRJUOIRNA-N | | SMILES | O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C=CC(=O)NC2=O)C[C@@H]1OP(N(C(C)C)C(C)C)OCCC#N |&1:25,27,37,r| |
| | DMT-dU-CE Phosphoramidite Usage And Synthesis |
| Description | 2'-Deoxy-5'-O-DMT-uridine 3'-CE phosphoramidite (DMT-dU-CE Phosphoramidite) is crucial for synthesizing investigative DNA and RNA oligonucleotides in biomedicine. It precisely incorporates 2'-deoxyuridine, playing a vital role in nucleic acid sequences with high efficiency and significance. | | Uses | Dmt-Du Amidite is used as a reactant in the synthesis of nucleotide related substances. |
| | DMT-dU-CE Phosphoramidite Preparation Products And Raw materials |
|