|
|
| | 1 2-DIME-3-PROPYLIMIDAZOLIUM BIS(TRIFLUO Basic information |
| Product Name: | 1 2-DIME-3-PROPYLIMIDAZOLIUM BIS(TRIFLUO | | Synonyms: | 1-propenyl-2,3-diMethyliMidazoliuM bis((trifluoroMethyl)sulfonyl)iMide;1 2-DIME-3-PROPYLIMIDAZOLIUM BIS(TRIFLUO;1,2-DIME-3-PROPYLIMIDAZOLIUM BIS(TRIFLUOROME-SULFONYL)IMIDE;1,2-Dimethyl-3-propylimidazoliumbis(trifluoromethylsulfonyl)imide,99%[DMPIIm];1,2-DIMETHYL-3-PROPYLIMIDAZOLIUM BIS(TRIFLUOROMETHYLSULFONYL) IMIDE [DMPLLM];2,3-DiMethyl-1-propyliMidazoliuM Bis(trifluoroMethanesulfonyl)iMide;1,2-DiMethyl-3-propyliMidazoliuM bis(trifluoroMethylsulfonyl)iMide [DMPIIM];1-propyl-2,3-dimethylimidazolium bis((trifluoromethyl)sulfonyl)imide | | CAS: | 169051-76-7 | | MF: | C8H15N2.C2F6NO4S2 | | MW: | 419.366 | | EINECS: | 805-807-9 | | Product Categories: | Chemical Synthesis;Imidazolium;organic amine;Ionic Liquids;Specialty Synthesis | | Mol File: | 169051-76-7.mol |  |
| | 1 2-DIME-3-PROPYLIMIDAZOLIUM BIS(TRIFLUO Chemical Properties |
| Melting point | 15 °C (lit.) | | density | 1.436 g/mL at 25 °C | | vapor pressure | 1.6-18.665hPa at 20-260℃ | | refractive index | n20/D 1.433 | | Fp | >110°C | | storage temp. | Store at room temperature, keep dry and cool | | form | liquid | | Specific Gravity | 1.47 | | color | colorless to pale yellow | | InChI | 1S/C8H15N2.C2F6NO4S2/c1-4-5-10-7-6-9(3)8(10)2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h6-7H,4-5H2,1-3H3;/q+1;-1 | | InChIKey | XOZHIVUWCICHSQ-UHFFFAOYSA-N | | SMILES | CCC[n+]1ccn(C)c1C.FC(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F | | LogP | 2.369 at 25℃ and pH6-7 | | CAS DataBase Reference | 169051-76-7 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29350090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 1 2-DIME-3-PROPYLIMIDAZOLIUM BIS(TRIFLUO Usage And Synthesis |
| | 1 2-DIME-3-PROPYLIMIDAZOLIUM BIS(TRIFLUO Preparation Products And Raw materials |
|