VH 101, phenol manufacturers
- VH 101, phenol
-
- $35.00
-
2026-07-20
- CAS:2306193-99-5
- Purity: 98.18%
- Supply Ability: 10g
|
| | VH 101, phenol Basic information |
| Product Name: | VH 101, phenol | | Synonyms: | E3 ligase Ligand 19;VH 101, phenol;(2S,4R)-1-((S)-2-(1-fluorocyclopropanecarboxamido)-3,3-dimethylbutanoyl)-4-hydroxy-N-(2-hydroxy-4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide;Phenolic VH101;Inhibitor,E3 ligase-recruiting Moiety,inhibit,VHL ligand3,Ligands for E3 Ligase,VH032 cyclopropane F,VH032cyclopropaneF,VHL ligand-3,VH-032-cyclopropane-F;(2S,4R)-1-[(2S)-2-[(1-fluorocyclopropyl)formamido]-3,3-dimethylbutanoyl]-4-hydroxy-N-{[2-hydroxy-4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl}pyrrolidine-2-carboxamide;VH032-cyclopropane-F, 10 mM in DMSO;(2S,4R)-1-((S)-2-(1-Fluorocyclopropane-1-carboxamido)-3,3-dimethylbutanoyl)-4-hydroxy-N-(2-hydroxy-4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide | | CAS: | 2306193-99-5 | | MF: | C26H33FN4O5S | | MW: | 532.63 | | EINECS: | | | Product Categories: | | | Mol File: | 2306193-99-5.mol |  |
| | VH 101, phenol Chemical Properties |
| Boiling point | 841.7±65.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in DMSO | | pka | 9.12±0.35(Predicted) | | form | Solid | | color | White to yellow | | InChIKey | OKBLHQUBMCCFKE-LVCYWYKZSA-N | | SMILES | C([C@@H](NC(=O)C1(F)CC1)[C@@](C)(C)C)(=O)N2[C@H](C(NCC3=C(O)C=C(C=C3)C4=C(C)N=CS4)=O)C[C@@H](O)C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | VH 101, phenol Usage And Synthesis |
| Uses |
VH032-cyclopropane-F (VH 101, phenol) is a functionalized von-Hippel-Lindau (VHL) ligand with a terminal hydroxyl group. Allows rapid conjugation with many linkers containing active leaving groups. A basic building block for development of a protein degrader library.
| | reaction suitability | reagent type: ligand | | IC 50 | VHL | | storage | Store at +4°C |
| | VH 101, phenol Preparation Products And Raw materials |
|