|
|
| | (-)-DIHYDROCARVEOL Basic information |
| Product Name: | (-)-DIHYDROCARVEOL | | Synonyms: | (1R,2R,5R)-5-ISOPROPENYL-2-METHYLCYCLOHEXANOL;DIHYDROCARVEOL, (-)-;(1R,2R,5R)-2-Methyl-5-(1-methylethenyl)cyclohexanol;(1R,2R,5R)-2-Methyl-5-isopropenylcyclohexanol;(-)-Dihydrocarveol mixture of isomers, >=95.0% (sum of enantiomers, GC);Cyclohexanol, 2-methyl-5-(1-methylethenyl)-, (1R,2R,5R)-;l-Dihydrocarveol;(-)-Dihydrocarveol | | CAS: | 20549-47-7 | | MF: | C10H18O | | MW: | 154.25 | | EINECS: | | | Product Categories: | | | Mol File: | 20549-47-7.mol |  |
| | (-)-DIHYDROCARVEOL Chemical Properties |
| density | 0.926 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.476 | | Fp | 90℃ | | Specific Gravity | 0.927 | | Optical Rotation | [α]20/D 20±1°, neat | | BRN | 2433199 | | InChI | 1S/C10H18O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-11H,1,4-6H2,2-3H3/t8-,9-,10-/m1/s1 | | InChIKey | KRCZYMFUWVJCLI-OPRDCNLKSA-N | | SMILES | C[C@@H]1CC[C@H](C[C@H]1O)C(C)=C | | LogP | 2.915 (est) |
| Safety Statements | 23-24/25 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | (-)-DIHYDROCARVEOL Usage And Synthesis |
| Uses | (-)-Dihydrocarveol is a metabolite that can be extracted from actinomycetes[1]. | | Definition | ChEBI: The (1R,2R,4R)-stereoisomer of dihydrocarveol. | | References | [1] Yoshiaki Noma (1980) Conversion of ()-Carvone by Strains of Streptomyces, A-5–1, and Nocardia, 1–3–11, Agricultural and Biological Chemistry, 44:4, 807-812. |
| | (-)-DIHYDROCARVEOL Preparation Products And Raw materials |
|