| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Benzyl Butyl Phthalate-d4
CAS:93951-88-3
Package:250Mg,25Mg
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Benzyl n-Butyl Phthalate-d4
CAS:93951-88-3
Remarks:CS-C-00366
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Benzyl butyl phthalate-d4
CAS:93951-88-3
Purity:99% Package:10mg;100mg;1g
|
|
| | BENZYL BUTYL PHTHALATE-D4 Basic information |
| Product Name: | BENZYL BUTYL PHTHALATE-D4 | | Synonyms: | BENZYL N-BUTYL PHTHALATE-3,4,5,6-D4;BENZYL N-BUTYL PHTHALATE-D4;BENZYL BUTYL PHTHALATE-D4;BENZYL BUTYL PHTHALATE (RING-D4);BUTYL BENZYL PHTHALATE-D4;BUTYL BENZYL PHTHALATE (RING-D4);Benzyl butyl phthalate-3,4,5,6-d4;Phthalic acid, benzylbutyl ester D4 (3,4,5,6) | | CAS: | 93951-88-3 | | MF: | C19H20O4 | | MW: | 312.37 | | EINECS: | | | Product Categories: | Alphabetical Listings;B;Stable Isotopes;Aromatics;Isotope Labelled Compounds;Metabolites & Impurities | | Mol File: | 93951-88-3.mol |  |
| | BENZYL BUTYL PHTHALATE-D4 Chemical Properties |
| density | 1.114 g/mL at 25 °C | | Fp | 113 °C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | InChI | 1S/C19H20O4/c1-2-3-13-22-18(20)16-11-7-8-12-17(16)19(21)23-14-15-9-5-4-6-10-15/h4-12H,2-3,13-14H2,1H3/i7D,8D,11D,12D | | InChIKey | IRIAEXORFWYRCZ-CXRURWBMSA-N | | SMILES | [2H]c1c([2H])c([2H])c(C(=O)OCc2ccccc2)c(c1[2H])C(=O)OCCCC | | CAS Number Unlabeled | 85-68-7 |
| Hazard Codes | T,N | | Risk Statements | 61-50/53-62 | | Safety Statements | 53-45-60-61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Repr. 1B |
| | BENZYL BUTYL PHTHALATE-D4 Usage And Synthesis |
| Uses | Labelled Benzyl Butyl Phthalate (B233555). A phthalate metabolite with genotoxic effect. |
| | BENZYL BUTYL PHTHALATE-D4 Preparation Products And Raw materials |
|