|
|
| | Bisabolol oxide A Basic information |
| Product Name: | Bisabolol oxide A | | Synonyms: | BISABOLOL, A-(-)-;BISABOLOL OXIDE A;CAMILLOL;HYDAGEN B;LEVOMENOL;DRAGOSANTOL;(3S,6S)-Tetrahydro-2,2,6-trimethyl-6-[(1S)-4-methyl-3-cyclohexen-1-yl]-2H-pyran-3-ol;A-(-)-BISABOLOL | | CAS: | 22567-36-8 | | MF: | C15H26O2 | | MW: | 238.37 | | EINECS: | 245-086-2 | | Product Categories: | | | Mol File: | 22567-36-8.mol |  |
| | Bisabolol oxide A Chemical Properties |
| Boiling point | 327.7±42.0℃ (760 Torr) | | density | 0.982±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 125.9±22.1℃ | | storage temp. | -20°C | | pka | 14.51±0.60(Predicted) | | form | Liquid | | color | Colorless to light yellow | | InChI | 1S/C15H26O2/c1-11-5-7-12(8-6-11)15(4)10-9-13(16)14(2,3)17-15/h5,12-13,16H,6-10H2,1-4H3/t12-,13+,15+/m1/s1 | | InChIKey | WJHRAVIQWFQMKF-IPYPFGDCSA-N | | SMILES | [H][C@@]1(CCC(C)=CC1)[C@]2(C)CC[C@H](O)C(C)(C)O2 | | LogP | 3.457 (est) |
| Hazard Codes | N | | Risk Statements | 51/53 | | Safety Statements | 61 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 2 |
| | Bisabolol oxide A Usage And Synthesis |
| Uses | Reference standard in the analysis of herbal medicinal products | | Definition | ChEBI: Bisabolol oxide A is a member of oxanes. |
| | Bisabolol oxide A Preparation Products And Raw materials |
|