|
|
| | (S)-3-AMINO-HEXAHYDRO-2-AZEPINONE Basic information |
| Product Name: | (S)-3-AMINO-HEXAHYDRO-2-AZEPINONE | | Synonyms: | (S)-3β-Aminohexahydro-1H-azepine-2-one;[S,(-)]-3-Aminohexahydro-1H-azepin-2-one;2H-Azepin-2-one, 3-aminohexahydro-, (3S)-;(3S)-3-Aminoazepan-2-one;L-(-)-ALPHA-AMINO-EPSILON-CAPROLACTAM;L-ALPHA-AMINO-EPSILON-CAPROLACTAM;L-2-AMINO-CYCLOHEPTALACTAM;(S)-3-AMINO-2-AZEPANONE | | CAS: | 21568-87-6 | | MF: | C6H12N2O | | MW: | 128.17 | | EINECS: | | | Product Categories: | | | Mol File: | 21568-87-6.mol |  |
| | (S)-3-AMINO-HEXAHYDRO-2-AZEPINONE Chemical Properties |
| Melting point | 97-101 °C | | Boiling point | 315.1±35.0 °C(Predicted) | | density | 1.031±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | Aqueous Acid (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 16.06±0.40(Predicted) | | form | Yellow Thick Oil to Semi-Solid | | Appearance | Light yellow to yellow Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C6H12N2O/c7-5-3-1-2-4-8-6(5)9/h5H,1-4,7H2,(H,8,9)/t5-/m0/s1 | | InChIKey | BOWUOGIPSRVRSJ-YFKPBYRVSA-N | | SMILES | N1CCCC[C@H](N)C1=O | | CAS DataBase Reference | 21568-87-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HS Code | 2933998090 |
| | (S)-3-AMINO-HEXAHYDRO-2-AZEPINONE Usage And Synthesis |
| Uses | (S)-3-Amino-2-azepanone is used as an intermediate in the synthesis of bengamide E analogs and capuramycin and its analogs as antibacterial agents. | | Definition | ChEBI: L-2-aminohexano-6-lactam is a 2-aminohexano-6-lactam derived from L-lysine. It is a L-lysine derivative and a 2-aminohexano-6-lactam. It is a conjugate base of a L-2-ammoniohexano-6-lactam. It is an enantiomer of a D-2-aminohexano-6-lactam. |
| | (S)-3-AMINO-HEXAHYDRO-2-AZEPINONE Preparation Products And Raw materials |
|