|
|
| | N-CAPRIC ACID N-DECYL ESTER Basic information |
| Product Name: | N-CAPRIC ACID N-DECYL ESTER | | Synonyms: | N-CAPRIC ACID N-DECYL ESTER;n-capricacidn-decylester95+%;DECANOIC ACID DECYL ESTER;DECYL DECANOATE;Decyl Decanoate >;Decyl caprate;Decyl Decanoate, 95%+;Capryl caprate | | CAS: | 1654-86-0 | | MF: | C20H40O2 | | MW: | 312.53 | | EINECS: | 216-729-4 | | Product Categories: | | | Mol File: | 1654-86-0.mol |  |
| | N-CAPRIC ACID N-DECYL ESTER Chemical Properties |
| Melting point | 9.7°C | | Boiling point | 159 °C / 2mmHg | | density | 0.86 | | refractive index | 1.4410-1.4430 | | Fp | 140 °C | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C20H40O2/c1-3-5-7-9-11-13-15-17-19-22-20(21)18-16-14-12-10-8-6-4-2/h3-19H2,1-2H3 | | InChIKey | XAKXZZPEUKNHMA-UHFFFAOYSA-N | | SMILES | C(OCCCCCCCCCC)(=O)CCCCCCCCC | | LogP | 8.937 (est) | | CAS DataBase Reference | 1654-86-0 | | EPA Substance Registry System | Decanoic acid, decyl ester (1654-86-0) |
| TSCA | TSCA listed | | HS Code | 2915.90.5050 |
| | N-CAPRIC ACID N-DECYL ESTER Usage And Synthesis |
| Uses | Decyl Decanoate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | | Definition | ChEBI: Decyl decanoate is a carboxylic ester. | | Synthesis | Method 1: n-decanoic acid n-decyl ester was prepared as follows: 1 mol n-decanol and 1 mol n-decanoic acid and 0.22 g 0.22 g 2001 (tin oxalate) were heated in an aqueous separator at a temperature of 240 C for 3 hours. The product was evaporated via a 30 cm column (153-168 C, 0.8 mbar). The product was a colorless, odorless oil.
Method 2: In a reaction kettle, 348 parts of decanoic acid, 383 parts of decanol, 0.30 parts of catalyst stannous oxide, 1.0 part of activated carbon were added sequentially, N2 was passed, the temperature was gradually increased under stirring, and the reaction was held for 6 hours at a temperature of 160-170C. The reaction-generated water was distilled, and after the end of the holding time, the product was transferred to a deethanolization kettle, and the product was held at a temperature of 160C and a vacuum of 100 Pa for 30 minutes, and then the temperature was reduced to 70 Decanoic acid decanol ester was obtained by filtration at , and the esterification rate was 99.3%. |
| | N-CAPRIC ACID N-DECYL ESTER Preparation Products And Raw materials |
|