|
|
| | phosphinylidynetrimethanol Basic information |
| Product Name: | phosphinylidynetrimethanol | | Synonyms: | phosphinylidynetrimethanol;Tris(hydroxymethyl)phosphine oxide;Phosphinylidynetrismethanol;Phosphinylidyntrimethanol;Bis(hydroxymethyl)phosphorylmethanol;JACS-1067-12-5;Methanol, 1,1',1''-phosphinylidynetris-;TIANFUCHEM--1067-12-5---phosphinylidynetrimethanol | | CAS: | 1067-12-5 | | MF: | C3H9O4P | | MW: | 140.07 | | EINECS: | 213-924-6 | | Product Categories: | | | Mol File: | 1067-12-5.mol |  |
| | phosphinylidynetrimethanol Chemical Properties |
| Melting point | 56-58 °C | | Boiling point | 504.9±45.0 °C(Predicted) | | density | 1.478±0.06 g/cm3(Predicted) | | vapor pressure | 0.001Pa at 25℃ | | pka | 12.26±0.10(Predicted) | | Water Solubility | 1000g/L at 25℃ | | InChI | InChI=1S/C3H9O3P/c4-1-7(2-5)3-6/h4-6H,1-3H2 | | InChIKey | JMXMXKRNIYCNRV-UHFFFAOYSA-N | | SMILES | P(CO)(CO)CO | | LogP | -4.77 | | CAS DataBase Reference | 1067-12-5 | | EPA Substance Registry System | Methanol, phosphinylidynetris- (1067-12-5) |
| | phosphinylidynetrimethanol Usage And Synthesis |
| | phosphinylidynetrimethanol Preparation Products And Raw materials |
|