|
|
| | 4-diazo-4H-imidazole-5-carboxamide Basic information |
| | 4-diazo-4H-imidazole-5-carboxamide Chemical Properties |
| Melting point | 205-2100C (dec) | | Boiling point | 251.91°C (rough estimate) | | density | 1.5530 (rough estimate) | | refractive index | 1.8000 (estimate) | | storage temp. | Refrigerator | | solubility | DMSO (Sparingly), Methanol (Slightly, Heated, Sonicated), Water (Slightly, Heated) | | form | Solid | | color | Beige to Light Brown | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C4H3N5O/c5-3(10)2-4(9-6)8-1-7-2/h1H,(H2,5,10) | | InChIKey | IKZLMSPFYNDYIL-UHFFFAOYSA-N | | SMILES | [N+](=[N-])=C1N=CN=C1C(=O)N | | CAS DataBase Reference | 7008-85-7 |
| WGK Germany | WGK 3 | | HS Code | 2933290000 | | Storage Class | 11 - Combustible Solids |
| | 4-diazo-4H-imidazole-5-carboxamide Usage And Synthesis |
| Chemical Properties | Pale-Pink Solid | | Uses | Temozolomide USP Related Compound A | | Synthesis Reference(s) | The Journal of Organic Chemistry, 26, p. 2396, 1961 DOI: 10.1021/jo01351a060 |
| | 4-diazo-4H-imidazole-5-carboxamide Preparation Products And Raw materials |
|