|
|
| | AC-TRP-NH2 Basic information |
| | AC-TRP-NH2 Chemical Properties |
| Melting point | 194-196 °C(lit.) | | Boiling point | 388.24°C (rough estimate) | | density | 1.1477 (rough estimate) | | refractive index | 1.5600 (estimate) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 14.90±0.46(Predicted) | | form | powder | | color | white to off-white | | Optical Rotation | 20.32°(C=0.51g/100mI, MEOH, 20°C, 589nm) | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Major Application | detection | | InChI | InChI=1/C13H15N3O2/c1-8(17)16-12(13(14)18)6-9-7-15-11-5-3-2-4-10(9)11/h2-5,7,12,15H,6H2,1H3,(H2,14,18)(H,16,17)/t12-/s3 | | InChIKey | HNGIZKAMDMBRKJ-PLAQIDKDNA-N | | SMILES | C12C=CC=CC=1NC=C2C[C@@H](C(=O)N)NC(=O)C |&1:10,r| | | CAS DataBase Reference | 2382-79-8 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | AC-TRP-NH2 Usage And Synthesis |
| Chemical Properties | white powder | | Uses | detection | | Definition | ChEBI: (2S)-2-acetamido-3-(1H-indol-3-yl)propanamide is a primary carboxamide, a secondary carboxamide, a member of acetamides and a L-tryptophan derivative. | | Biological Activity | N-Acetyl-L-tryptophanamide (NATA) is an N-terminal and C-terminal blocked analogue of L-tryptophan. L-tryptophan, NATA and NATA-tyr molecules have intrinsic fluorescence which makes them useful in studies involving fluorescence and flurosence enhancement. |
| | AC-TRP-NH2 Preparation Products And Raw materials |
|