|
|
| | 4-Acetylamino-2-(diallylamino)anisole Basic information |
| Product Name: | 4-Acetylamino-2-(diallylamino)anisole | | Synonyms: | N[3-(DI-2-PROPENYLAMINO)-4-METHOXYPHENYL]ACETAMIDE;4-ACETYLAMINO-2-(DIALLYLAMINO)ANISOLE;3-(N,N-DIALLYL)AMINO-4-METHOXY ACETANILIDE;3'-(DIALLYLAMINO)-4'-METHOXYACETANILIDE;N-[3-(di-2-propenylamino)-4-methoxyphenyl]-Acetamide 3-(n,n-diallyl) amino-4-methoxyacetanilide;5-Acetamido-N,N-diallyl-o-anisidine;3'-(di-2-propenylamino)-4'-methoxyacetanilide;3-DIALLYL AMINO-4-METHOXY ACETANILIDE 98+% | | CAS: | 51868-45-2 | | MF: | C15H20N2O2 | | MW: | 260.33 | | EINECS: | | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 51868-45-2.mol |  |
| | 4-Acetylamino-2-(diallylamino)anisole Chemical Properties |
| Melting point | 75-78 °C (lit.) | | Boiling point | 416.4±45.0 °C(Predicted) | | density | 1.081±0.06 g/cm3(Predicted) | | pka | 14.19±0.70(Predicted) | | InChI | 1S/C15H20N2O2/c1-5-9-17(10-6-2)14-11-13(16-12(3)18)7-8-15(14)19-4/h5-8,11H,1-2,9-10H2,3-4H3,(H,16,18) | | InChIKey | GGUYNLUBFGZIKN-UHFFFAOYSA-N | | SMILES | COc1ccc(NC(C)=O)cc1N(CC=C)CC=C | | CAS DataBase Reference | 51868-45-2(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 4-Acetylamino-2-(diallylamino)anisole Usage And Synthesis |
| Uses | N-[3-(Di-2-propen-1-ylamino)-4-methoxyphenyl]-acetamide is a useful organic building block. |
| | 4-Acetylamino-2-(diallylamino)anisole Preparation Products And Raw materials |
|