|
|
| | CYCLOPROPANECARBOTHIOAMIDE Basic information |
| Product Name: | CYCLOPROPANECARBOTHIOAMIDE | | Synonyms: | CYCLOPROPANECARBOTHIOAMIDE;CyclopropanethiocarboxaMide, 97%;Cyclpropanecarbothioamide;Cyclopropanecar;Cyclopropanecarbothioamide - [C6789];Cyclopropanethiocarboxamide | | CAS: | 20295-34-5 | | MF: | C4H7NS | | MW: | 101.17 | | EINECS: | | | Product Categories: | | | Mol File: | 20295-34-5.mol |  |
| | CYCLOPROPANECARBOTHIOAMIDE Chemical Properties |
| Melting point | 111-113℃ | | Boiling point | 176.9±23.0 °C(Predicted) | | density | 1.272±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, sealed storage, away from moisture | | pka | 13.19±0.20(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C4H7NS/c5-4(6)3-1-2-3/h3H,1-2H2,(H2,5,6) | | InChIKey | IIPJWNFOLPDTEQ-UHFFFAOYSA-N | | SMILES | C1(C(N)=S)CC1 | | CAS DataBase Reference | 20295-34-5 |
| HazardClass | IRRITANT | | HS Code | 2930909899 |
| | CYCLOPROPANECARBOTHIOAMIDE Usage And Synthesis |
| Description | Cyclopropanecarbothioamide is used for purification of thiazolo [5, 4-b] pyridine-and thiazolo [5, 4-c] pyridine derivatives from chloronitropyridines and thioamides, or thioureas during the simple-step reaction. It is also a useful chemical during the proteomics study. Recent study has also used it for synthesis of a novel heterocyclic compound, CE-125, which can improve working memory in the radial arm maze and modulate the dopamine receptor D1R in frontal cortex of the Sprague-Dawley rat. | | Uses | Cyclopropanecarbothioamide is used for purification in single-step preparation of thiazolo [5, 4-b] pyridine-and thiazolo [5, 4-c] pyridine derivatives from chloronitropyridines and thioamides, or thioureas. | | References | https://www.alfa.com/en/catalog/H32315/
Hussein, A. M., et al. "A novel heterocyclic compound improves working memory in the radial arm maze and modulates the dopamine receptor D1R in frontal cortex of the Sprague-Dawley rat." Behavioural Brain Research 332(2017):308-315. |
| | CYCLOPROPANECARBOTHIOAMIDE Preparation Products And Raw materials |
|