- Forsythoside B
-
- $33.00
-
2026-04-22
- CAS:81525-13-5
- Purity: 99.81%
- Supply Ability: 10g
- Forsythoside B
-
-
2024-04-12
- CAS:81525-13-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000ton
- Forsythoside B
-
-
2023-02-24
- CAS:81525-13-5
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | Forsythoside B Basic information |
| Product Name: | Forsythoside B | | Synonyms: | Forsythoside B;(E)-O-D-Apio-beta-D-furanosyl-(1-6)-O-[6-deoxy-alpha-L-mannopyranosyl-(1-3)]-beta-D-glucopyranoside 2-(3,4-dihydroxyphenyl)ethyl 4-[3-(3,4-dihydroxyphenyl)-2-propenoate];Forsythoside B, 98%, from Callicarpa kwangtungensis Chun;β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→6)-O-[6-deoxy-α-L-mannopyranosyl-(1→3)]-, 4-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate];[(2R,3R,4R,5R,6R)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate;(2R,3R,4R,5R,6R)-2-((((2R,3R,4R)-3,4-Dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl)oxy)methyl)-6-(3,4-dihydroxyphenethoxy)-5-hydroxy-4-(((2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-3-yl (E)-3-(3,4-dihydroxyphenyl)acrylate;(2R,3R,4R,5R,6R)-2-((((2R,3R,4R)-3,4-Dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl)oxy)methyl)-6-(3,4-dihydroxyphenethoxy)-5-hydroxy-4-(((2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-3-yl (E)-3-(3,4-dihydroxyphenyl)acrylate , Forsythoside B;Forsythoside B-RM | | CAS: | 81525-13-5 | | MF: | C34H44O19 | | MW: | 756.7 | | EINECS: | 1592732-453-0 | | Product Categories: | reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;chemical reagent;pharmaceutical intermediate;phytochemical | | Mol File: | 81525-13-5.mol |  |
| | Forsythoside B Chemical Properties |
| Boiling point | 1040.3±65.0 °C(Predicted) | | density | 1.65 | | storage temp. | 2-8°C | | solubility | Methanol (Slightly) | | form | Solid | | pka | 9.31±0.10(Predicted) | | color | Off-White to Light Brown | | Stability: | Hygroscopic | | Major Application | food and beverages | | InChIKey | JMBINOWGIHWPJI-MJJXKKHKNA-N | | SMILES | O1[C@H]([C@@H]([C@@](C1)(O)CO)O)OC[C@H]2O[C@H]([C@@H]([C@H]([C@@H]2OC(=O)\C=C\c5cc(c(cc5)O)O)O[C@@H]4O[C@H]([C@@H]([C@H]([C@H]4O)O)O)C)O)OCCc3cc(c(cc3)O)O |
| WGK Germany | WGK 3 | | HS Code | 29389090 | | Storage Class | 11 - Combustible Solids |
| | Forsythoside B Usage And Synthesis |
| Chemical Properties | Off-white crystalline powder, easily soluble in methanol, derived from Guangdong Callicarpa ovata and Phyllanthus urinaria. | | Uses | Forsythoside B is an anti-inflammatory agent protecting against such effects such as sepsis. Neuroprotective agent. |
| | Forsythoside B Preparation Products And Raw materials |
|