|
|
| | 4-BROMO-5-METHYL-1H-INDAZOLE Basic information |
| | 4-BROMO-5-METHYL-1H-INDAZOLE Chemical Properties |
| Boiling point | 344.6±22.0 °C(Predicted) | | density | 1.654±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 13.01±0.40(Predicted) | | color | White to off-white | | InChI | InChI=1S/C8H7BrN2/c1-5-2-3-7-6(8(5)9)4-10-11-7/h2-4H,1H3,(H,10,11) | | InChIKey | YBLXBXPJJAZHDS-UHFFFAOYSA-N | | SMILES | N1C2=C(C(Br)=C(C)C=C2)C=N1 | | CAS DataBase Reference | 926922-40-9 |
| | 4-BROMO-5-METHYL-1H-INDAZOLE Usage And Synthesis |
| Uses | 4-Bromo-5-methyl-1H-indazole can be used as a functional group in organic synthesis to participate in the synthesis and modification of polymer materials. By introducing this compound, the thermal stability, mechanical strength and other properties of the material can be improved to meet the needs of specific fields. | | Hazard | 4-Bromo-5-methyl-1H-indazole is irritating to the eyes and skin. Inhalation may cause respiratory irritation. | | Synthesis | 4-Bromo-5-methyl-1H-indazole is synthesised using 2-bromo-4-fluorotoluene as the starting material. The specific reaction steps are as follows: 2-bromo-4-fluorotoluene reacts with lithium diisopropylamine to form a lithium reagent. This lithium reagent reacts with dimethylformamide to form compound (III). Compound (III) reacts with methoxyamine hydrochloride and potassium carbonate to yield compound (IV). Compound (IV) undergoes a ring-closing reaction in the presence of hydrazine hydrate to form 4-bromo-5-methyl-1H-indazole.
 |
| | 4-BROMO-5-METHYL-1H-INDAZOLE Preparation Products And Raw materials |
|