- 4-methoxycinnamicacid
-
- $25.00
-
2023-03-27
- CAS:943-89-5
- Min. Order: 1KG
- Purity: 0.99
- Supply Ability: 20 tons
|
| | trans-O-Methyl-p-coumaric acid Basic information |
| Product Name: | trans-O-Methyl-p-coumaric acid | | Synonyms: | 4-METHOXYCINNAMIC ACID ABOUT 98%;trans-4-Methoxycinnamic acid, 98+%;4-Methoxy-trans-cinnamic acid;p-Methoxy-trans-cinnamic acid;4-Methoxycinnamic acid >=98.0% (GC);trans-4-MethoxyClnnamic acid;4-Methoxycinnamic acid;RARECHEM BK HC T257 | | CAS: | 943-89-5 | | MF: | C10H10O3 | | MW: | 178.18 | | EINECS: | 213-405-4 | | Product Categories: | Benzenes;943-89-5 | | Mol File: | 943-89-5.mol |  |
| | trans-O-Methyl-p-coumaric acid Chemical Properties |
| Melting point | 173.5 °C(lit.) | | Boiling point | 342.6±17.0 °C(Predicted) | | density | 1.195±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in ethanol, ethyl acetate and other organic solvents. | | pka | 4.60±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 510468 | | Cosmetics Ingredients Functions | UV FILTER LIGHT STABILIZER | | InChI | InChI=1S/C10H10O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-4+ | | InChIKey | AFDXODALSZRGIH-QPJJXVBHSA-N | | SMILES | C(O)(=O)/C=C/C1=CC=C(OC)C=C1 | | LogP | 1.264 (est) | | CAS DataBase Reference | 943-89-5(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Propenoic acid, 3-(4-methoxyphenyl)-, (e)-(943-89-5) | | EPA Substance Registry System | 2-Propenoic acid, 3-(4-methoxyphenyl)-, (2E)- (943-89-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | UD3391300 | | F | 8 | | TSCA | TSCA listed | | HS Code | 2918.29.7500 | | HazardClass | IRRITANT | | Storage Class | 13 - Non Combustible Solids |
| | trans-O-Methyl-p-coumaric acid Usage And Synthesis |
| Uses | Esters derived from trans-4-methoxycinnamic acid are effective absorbers of UV radiation. The starting material was trans-4-methoxycinnamic acid and 3,5dimethoxybenzoic acid methyl ester in isolated avenanthramide alkaloids synthsis. trans-4-Methoxycinnamic acid was converted into its acid chloride (yield 98%) with thionyl chloride. Employed in organic synthesis of pharmaceutical intermediates, synthetic anti-adrenergic drugs esmolol, cosmetics ultraviolet absorption. | | Preparation | 4-methoxycinnamic acid synthesis : In a 25-mL, roundbottomed flask, 4-methoxybenzaldehyde (0.804 mL, 6.61 mmol) (3), malonic acid (1.75 g, 16.8 mmol), and β-alanine (0.10 g, 1.12 mmol) were dissolved in pyridine (3.0 mL, 37.1 mmol) and heated under reflux for 90 minutes. After cooling to room temperature, the reaction mixture was placed in an ice bath and 8.0 mL of concentrated HCl was slowly added. The resulting white precipitate was collected by vacuum filtration, washed with cold water (2 x 10mL) and dried thoroughly. The product was recrystallized from absolute ethanol (~20 mL). Synthesis of 4-methoxycinnamic acid | | Definition | ChEBI: 4-methoxycinnamic acid is a methoxycinnamic acid having a single methoxy substituent at the 4-position on the phenyl ring. It is functionally related to a cinnamic acid. | | Purification Methods | Crystallise the acid from MeOH to constant melting point and UV spectrum. [Beilstein 10 IV 1005.] |
| | trans-O-Methyl-p-coumaric acid Preparation Products And Raw materials |
|