- 2-Bromo-m-xylene
-
- $10.00
-
2026-05-28
- CAS:576-22-7
- Min. Order: 1KG
- Purity: 99.%
- Supply Ability: 10 ton
- 2-Bromo-m-xylene
-
-
2026-03-20
- CAS:576-22-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 mt
|
| | 2-Bromo-m-xylene Basic information |
| | 2-Bromo-m-xylene Chemical Properties |
| Melting point | −10 °C(lit.) | | Boiling point | 206 °C(lit.) | | density | 1.389 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.555(lit.) | | Fp | 165 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in aqueous solution. Very soluble in ethanol, soluble in acetone and benzene. | | form | Liquid | | color | Clear colorless to yellow | | Specific Gravity | 1.389 | | BRN | 1929780 | | InChI | InChI=1S/C8H9Br/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 | | InChIKey | MYMYVYZLMUEVED-UHFFFAOYSA-N | | SMILES | C1(C)=CC=CC(C)=C1Br | | CAS DataBase Reference | 576-22-7(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 2-bromo-1,3-dimethyl-(576-22-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | RIDADR | UN 2810 | | WGK Germany | 3 | | RTECS | CY9020000 | | HazardClass | IRRITANT | | HS Code | 29039990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Bromo-m-xylene Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS TO YELLOW LIQUID | | Uses | 2-Bromo-m-xylene has been used to prepare 2,2,4,6,6-pentamethylbiphenyl. It is used as an intermediate in organic synthesis. |
| | 2-Bromo-m-xylene Preparation Products And Raw materials |
| Raw materials | 2,4-Dimethylbromobenzene-->m-Xylene | | Preparation Products | 2-Bromo-3-methylbenzoic acid-->2-(2,6-DIMETHYLPHENYL)ETHANOL-->2-bromo-5-(tert-butyl)-1,3-dimethylbenzene-->2,6-DIMETHYLACETOPHENONE-->1,3-Benzenedicarboxylic acid, 2-broMo-, 1,3-diMethyl ester-->DiMethyl 2-Hydroxyisophthalate-->2,6-Dimethylbenzyl bromide-->2,5-DIBROMO-M-XYLENE-->1,3-DIMETHYL-2-ETHYLBENZENE-->2,6-Dimethylfluorobenzene-->2',2,2,6'-TETRAMETHYLPROPIOPHENONE |
|