|
|
| | FMOC-ILE-OPFP Basic information |
| Product Name: | FMOC-ILE-OPFP | | Synonyms: | FMOC-ISOLEUCINE-OPFP;FMOC-ILE-OPFP;FMOC-L-ISOLEUCINE PENTAFLUOROPHENYL ESTER;N-ALPHA-FMOC-L-ISOLEUCINE PENTAFLUOROPHENYL ESTER;Fmoc-L-Ile-OPfp;NALPHA-9-Fluorenylmethoxycarbonyl-L-isoleucine pentafluorophenyl ester;N(fluorenylmethoxycarbonyl)-L-isoleucine pentafluorophenyl;(2S,3S)-perfluorophenyl 2-(((9H-fluoren-9-yl)methoxy)carbonylamino)-3-methylpentanoate | | CAS: | 86060-89-1 | | MF: | C27H22F5NO4 | | MW: | 519.46 | | EINECS: | | | Product Categories: | Fmoc-Amino Acids and Derivatives;Fmoc-Amino acid series;Amino Acids | | Mol File: | 86060-89-1.mol |  |
| | FMOC-ILE-OPFP Chemical Properties |
| Melting point | 73-75℃ | | Boiling point | 596.3±50.0 °C(Predicted) | | density | 1.350±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 10.32±0.46(Predicted) | | BRN | 4221390 | | Major Application | peptide synthesis | | InChIKey | FYZSBHSHLNJGPS-RZFZLAGVSA-N | | SMILES | C(OC1=C(F)C(F)=C(F)C(F)=C1F)(=O)[C@H]([C@@H](C)CC)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 86060-89-1 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2924 29 70 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | FMOC-ILE-OPFP Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-ILE-OPFP Preparation Products And Raw materials |
|