| Company Name: |
TCI (Shanghai) Development Co., Ltd.
|
| Tel: |
021-67121386 |
| Email: |
Sales-CN@TCIchemicals.com |
| Products Intro: |
Product Name:Pentafluorophenyl Benzoate
CAS:1548-84-1
Purity:98.0% GC Package:1G,5G
|
| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:Pentafluorophenyl Benzoate
CAS:1548-84-1
Purity:98%+ Package:250mg;1g;5g;25g;100g
|
|
| | Benzoic acid pentafluorophenyl ester, BzOPfp Basic information |
| Product Name: | Benzoic acid pentafluorophenyl ester, BzOPfp | | Synonyms: | Perfluorophenyl benzoate;Benzoic acid pentafluorophenyl ester, BzOPfp;Pentafluorophenyl benzoate;Pentafluorophenyl Benzoate >;Phenol, 2,3,4,5,6-pentafluoro-, 1-benzoate;2,3,4,5,6-pentafluorophenylbenzoate | | CAS: | 1548-84-1 | | MF: | C13H5F5O2 | | MW: | 288.17 | | EINECS: | | | Product Categories: | | | Mol File: | 1548-84-1.mol |  |
| | Benzoic acid pentafluorophenyl ester, BzOPfp Chemical Properties |
| Melting point | 73-74 °C(lit.) | | Boiling point | 371.7±42.0 °C(Predicted) | | density | 1.486±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C13H5F5O2/c14-7-8(15)10(17)12(11(18)9(7)16)20-13(19)6-4-2-1-3-5-6/h1-5H | | InChIKey | WZPWTXZSQHIABL-UHFFFAOYSA-N | | SMILES | Fc1c(F)c(F)c(OC(=O)c2ccccc2)c(F)c1F || Fc1c(F)c(F)c(OC(=O)c2ccccc2)c(F)c1F | | CAS DataBase Reference | 1548-84-1 |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | WGK 3 | | HS Code | 2916310090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 |
| | Benzoic acid pentafluorophenyl ester, BzOPfp Usage And Synthesis |
| Uses | Active ester for the selective benzoylation of amino groups |
| | Benzoic acid pentafluorophenyl ester, BzOPfp Preparation Products And Raw materials |
|