| Company Name: |
Shengyan (Shanghai) New Materials Co. , Ltd.
|
| Tel: |
021-68093558 13585706261 |
| Email: |
ken@syanchem.com |
| Products Intro: |
Product Name:N-([1,1'-biphenyl]-4-yl)-5,9,9-trimethyl-9H-fluoren-2-amine CAS:3047587-64-1 Purity:99% HPLC Package:5KG;1KG 200G
|
|
| | N-([1,1'-biphenyl]-4-yl)-5,9,9-trimethyl-9H-fluoren-2-amine Basic information |
| | N-([1,1'-biphenyl]-4-yl)-5,9,9-trimethyl-9H-fluoren-2-amine Chemical Properties |
| Boiling point | 548.074±39.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.123±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 0.874±0.40(predicted) | | InChI | InChI=1S/C28H25N/c1-19-8-7-11-25-27(19)24-17-16-23(18-26(24)28(25,2)3)29-22-14-12-21(13-15-22)20-9-5-4-6-10-20/h4-18,29H,1-3H3 | | InChIKey | UQZIEUFBDMVNMX-UHFFFAOYSA-N | | SMILES | CC1C=CC=C2C(C3=CC(=CC=C3C2=1)NC1C=CC(C2C=CC=CC=2)=CC=1)(C)C |
| | N-([1,1'-biphenyl]-4-yl)-5,9,9-trimethyl-9H-fluoren-2-amine Usage And Synthesis |
| Uses | N-([1,1'-biphenyl]-4-yl)-5,9,9-trimethyl-9H-fluoren-2-amine is formed by adding a methyl group to the structure of N-(biphenyl-4-yl)-9,9-dimethyl-9H-fluoren-2-amine. This compound can be used as an OLED intermediate in the preparation of compounds for organic optoelectronic devices. |
| | N-([1,1'-biphenyl]-4-yl)-5,9,9-trimethyl-9H-fluoren-2-amine Preparation Products And Raw materials |
|