- H-AEEA-OH
-
-
2026-06-05
- CAS:134978-97-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | 2-(2-(2-Aminoethoxy)ethoxy)acetic acid Basic information |
| Product Name: | 2-(2-(2-Aminoethoxy)ethoxy)acetic acid | | Synonyms: | Amino-PEG2-CH2CO2H;Acetic acid,2-[2-(2-aminoethoxy)ethoxy]-;8-Amino-3,6-dioxaoctanoic acid≥ 99% (HPLC);2-(2-(2-Aminoethoxy)ethoxy)acetic acid;AMINE-PEG2-CH2COOH;H2N-(CH2CH2O)2-CH2COOH;Amino-PEG2-CH2COOH;2-(2-(2-Aminoethoxy)ethoxy)acetic acid ISO 9001:2015 REACH | | CAS: | 134978-97-5 | | MF: | C6H13NO4 | | MW: | 163.17 | | EINECS: | | | Product Categories: | peg;134978-97-5 | | Mol File: | 134978-97-5.mol |  |
| | 2-(2-(2-Aminoethoxy)ethoxy)acetic acid Chemical Properties |
| Melting point | 124.0 to 128.0 °C | | Boiling point | 323.8±22.0 °C(Predicted) | | density | 1.177 | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.37±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C6H13NO4/c7-1-2-10-3-4-11-5-6(8)9/h1-5,7H2,(H,8,9) | | InChIKey | RUVRGYVESPRHSZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)COCCOCCN | | CAS DataBase Reference | 134978-97-5 |
| | 2-(2-(2-Aminoethoxy)ethoxy)acetic acid Usage And Synthesis |
| Description | Amino-PEG2-CH2CO2H is a PEG compound containing an amino group with a terminal carboxylic acid. The amine group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Chemical Properties | White to off-white crystalline powder | | Uses | [2-(2-Aminoethoxy)ethoxy]acetic Acid is used in the development of chemically modified peptide nucleic acid (PNA) as a probe for qualitative and quantitative detection of DNA. It is also used in the preparation and studies of the biological activities of kappa agonist CovX-bodies. | | IC 50 | PEGs |
| | 2-(2-(2-Aminoethoxy)ethoxy)acetic acid Preparation Products And Raw materials |
|