|
|
| | tert-Butyl (S)-(5-benzyl-5-azaspiro[2.4]heptan-7-yl)carbamate Basic information |
| Product Name: | tert-Butyl (S)-(5-benzyl-5-azaspiro[2.4]heptan-7-yl)carbamate | | Synonyms: | Carbamic acid, [(7S)-5-(phenylmethyl)-5-azaspiro[2.4]hept-7-yl]-, 1,1-dimethylethyl ester;[(7S)-5-(Phenylmethyl)-5-azaspiro[2.4]hept-7-yl]carbamic acid tert-butyl ester;CarbaMic acid, N-[(7S)-5-(phenylMethyl)-5-azaspiro[2.4]hept-7-yl]-, 1,1-diMethylethyl ester;(S)-tert-Butyl (5-benzyl-5-azaspiro[2.4]heptan-7-yl)carbaMate;[(7S)-5-(Phenylmethyl)-5-azaspiro[2.4]hept-7-yl]carbamic;tert-butyl N-[(7S)-5-benzyl-5-azaspiro[2.4]heptan-7-yl]carbamate;tert-butyl (S)-(5-benzyl-5-azaspiro[2.4]heptan-7-yl)carbamate;Carbamic acid, [(7S)-5-(phenylmethyl)-5-azaspiro[2.4]hept-7-... | | CAS: | 144282-37-1 | | MF: | C18H26N2O2 | | MW: | 302.41 | | EINECS: | 1806241-263-5 | | Product Categories: | | | Mol File: | 144282-37-1.mol | ![tert-Butyl (S)-(5-benzyl-5-azaspiro[2.4]heptan-7-yl)carbamate Structure](CAS2/GIF/144282-37-1.gif) |
| | tert-Butyl (S)-(5-benzyl-5-azaspiro[2.4]heptan-7-yl)carbamate Chemical Properties |
| Boiling point | 420.5±34.0 °C(Predicted) | | density | 1.12 | | storage temp. | 2-8°C | | pka | 12.31±0.20(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C18H26N2O2/c1-17(2,3)22-16(21)19-15-12-20(13-18(15)9-10-18)11-14-7-5-4-6-8-14/h4-8,15H,9-13H2,1-3H3,(H,19,21)/t15-/m1/s1 | | InChIKey | UCBLMUMETZZNIZ-OAHLLOKOSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@H]1C2(CC2)CN(CC2=CC=CC=C2)C1 |
| | tert-Butyl (S)-(5-benzyl-5-azaspiro[2.4]heptan-7-yl)carbamate Usage And Synthesis |
| Synthesis |
3.75 g of 5-benzyl-5-azaspiro[2.4]heptan-7-amine was added to the reaction flask, followed by 35 mL of ethanol, 3.75 g of triethylamine and 6.5 g of Boc2O.Stir the reaction at room temperature for 12-14 hours, concentrate, add ethyl acetate, and then use aqueous lemon solution, sodium bicarbonate solution, and saturatedWashed with brine, dried, concentrated and dried to give tert-Butyl (S)-(5-benzyl-5-azaspiro[2.4]heptan-7-yl)carbamate.The yield was 98.2%.
|
| | tert-Butyl (S)-(5-benzyl-5-azaspiro[2.4]heptan-7-yl)carbamate Preparation Products And Raw materials |
|