|
|
| | diethyl 2-acetamido-2-(4-octylphenethyl)malonate Basic information |
| Product Name: | diethyl 2-acetamido-2-(4-octylphenethyl)malonate | | Synonyms: | diethyl 2-acetamido-2-(4-octylphenethyl)malonate;Fingolimod N-Acetyl Diethyl Ester;Fingolimod Impurity 25;1,3-Diethyl 2-(acetylamino)-2-[2-(4-octylphenyl)ethyl]propanedioate;Diethyl-2-acetamido-2- (4-octylphenylethyl) malonate;1,3-Diethyl 2-(acetcarboxcarboxcarboxamido)-2-[2-(4-octylphenyl)ethyl]propanedioate;2-(AcetylaMino)-2-[2-(4-octylphenyl)ethyl]propanedioic Acid 1,3-Diethyl Ester;Diethyl 2-(acetamido)-2-(2-(4-octylphenyl)ethyl)propanedioate | | CAS: | 162358-08-9 | | MF: | C25H39NO5 | | MW: | 433.58 | | EINECS: | 800-060-5 | | Product Categories: | Aromatics | | Mol File: | 162358-08-9.mol |  |
| | diethyl 2-acetamido-2-(4-octylphenethyl)malonate Chemical Properties |
| Melting point | 57-58°C | | Boiling point | 570.7±50.0 °C(Predicted) | | density | 1.043 | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly, Heated), Ethyl Acetate (Slightly) | | form | Solid | | pka | 12.17±0.46(Predicted) | | color | White to Pale Yellow | | InChI | InChI=1S/C25H39NO5/c1-5-8-9-10-11-12-13-21-14-16-22(17-15-21)18-19-25(26-20(4)27,23(28)30-6-2)24(29)31-7-3/h14-17H,5-13,18-19H2,1-4H3,(H,26,27) | | InChIKey | RYOKCHIAMHPMLV-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(NC(C)=O)(CCC1=CC=C(CCCCCCCC)C=C1)C(OCC)=O |
| | diethyl 2-acetamido-2-(4-octylphenethyl)malonate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | An impurity found in fingolimod (F805000). |
| | diethyl 2-acetamido-2-(4-octylphenethyl)malonate Preparation Products And Raw materials |
|