|
|
| | FMOC-HSE(ME)-OH Basic information |
| Product Name: | FMOC-HSE(ME)-OH | | Synonyms: | N-Fmoc-O-methyl-L-homoserine;Fmoc-L-HomoSer(Me)-OH;Fmoc-O-methyl-L-homoserine≥ 99% (HPLC);N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-O-METHYL-L-HOMOSERINE;N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-O-METHYL-L-HOMOSERINE;FMOC-L-HSE(ME)-OH;FMOC-HSE(ME)-OH;FMOC-HOSER(ME)-OH | | CAS: | 173212-86-7 | | MF: | C20H21NO5 | | MW: | 355.38 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | FMOC-HSE(ME)-OH Chemical Properties |
| Boiling point | 589.0±50.0 °C(Predicted) | | density | 1.259 | | storage temp. | Store at room temperature | | pka | 3.72±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C20H21NO5/c1-25-11-10-18(19(22)23)21-20(24)26-12-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,17-18H,10-12H2,1H3,(H,21,24)(H,22,23)/t18-/m0/s1 | | InChIKey | JBIRUWVMQYLPPX-SFHVURJKSA-N | | SMILES | C(O)(=O)[C@H](CCOC)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| | FMOC-HSE(ME)-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Fmoc-hse(me)-oh can be used to prepare peptidomimetic macrocycles as growth hormone-releasing hormone receptors to treat diseases and possesses improved bioavailability. |
| | FMOC-HSE(ME)-OH Preparation Products And Raw materials |
|