|
|
| | (3R,5R)-1-Boc-3,5-diMethylpiperazine Basic information |
| Product Name: | (3R,5R)-1-Boc-3,5-diMethylpiperazine | | Synonyms: | (3R,5R)-1-Boc-3,5-diMethylpiperazine;(3R,5R)-3,5-Dimethyl-1-piperazinecarboxylic Acid 1,1-Dimethylethyl Ester;1-Piperazinecarboxylic acid, 3,5-diMethyl-, 1,1-diMethylethyl ester, (3R,5R)-;(3R,5R)-tert-Butyl 3,5-diMethylpiperazine-1-carboxylate;tert-Butyl (3R,5R)-3,5-diMethylpiperazine-1-carboxylate | | CAS: | 438049-91-3 | | MF: | C11H22N2O2 | | MW: | 214.3 | | EINECS: | | | Product Categories: | | | Mol File: | 438049-91-3.mol |  |
| | (3R,5R)-1-Boc-3,5-diMethylpiperazine Chemical Properties |
| Boiling point | 279.7±15.0 °C(Predicted) | | density | 0.970±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 8.58±0.60(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C11H22N2O2/c1-8-6-13(7-9(2)12-8)10(14)15-11(3,4)5/h8-9,12H,6-7H2,1-5H3/t8-,9-/m1/s1 | | InChIKey | NUZXPHIQZUYMOR-RKDXNWHRSA-N | | SMILES | N1(C(OC(C)(C)C)=O)C[C@@H](C)N[C@H](C)C1 | | CAS DataBase Reference | 438049-91-3 |
| | (3R,5R)-1-Boc-3,5-diMethylpiperazine Usage And Synthesis |
| Uses | (3R,5R)-3,5-Dimethyl-1-piperazinecarboxylic Acid 1,1-Dimethylethyl Ester is used in the preparation of 5HT3 modulators and used in the treatment of CINV and IBS-D. It is also used in the preparation of 5-HT2 receptors. | | Uses | (3R,5R)-1-Boc-3,5-diMethylpiperazine is used in the preparation of 5HT3 modulators and used in the treatment of CINV and IBS-D. It is also used in the preparation o f 5-HT2 receptors. |
| | (3R,5R)-1-Boc-3,5-diMethylpiperazine Preparation Products And Raw materials |
|