|
|
| | 3-(Methylsulfonyl)phenylboronic Acid Pinacol Ester Basic information |
| Product Name: | 3-(Methylsulfonyl)phenylboronic Acid Pinacol Ester | | Synonyms: | 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[3-(methylsulfonyl)phenyl]-;3-(Methylsulfonyl)phenylboronic Acid Pinacol Ester;4,4,5,5-tetramethyl-2-(3-methylsulfonylphenyl)-1,3,2-dioxabo...;3-(Methylsulfonyl)benzeneboronic acid pinacol ester;4,4,5,5-tetramethyl-2-(3-(methylsulfonyl)phenyl)-1,3,2-dioxaborolane | | CAS: | 1001185-88-1 | | MF: | C13H19BO4S | | MW: | 282.16 | | EINECS: | | | Product Categories: | | | Mol File: | 1001185-88-1.mol |  |
| | 3-(Methylsulfonyl)phenylboronic Acid Pinacol Ester Chemical Properties |
| Boiling point | 440.5±37.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C13H19BO4S/c1-12(2)13(3,4)18-14(17-12)10-7-6-8-11(9-10)19(5,15)16/h6-9H,1-5H3 | | InChIKey | UERYNIKUFOCEAB-UHFFFAOYSA-N | | SMILES | CC1(OB(C2=CC=CC(S(C)(=O)=O)=C2)OC1(C)C)C |
| Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-(Methylsulfonyl)phenylboronic Acid Pinacol Ester Usage And Synthesis |
| | 3-(Methylsulfonyl)phenylboronic Acid Pinacol Ester Preparation Products And Raw materials |
|