|
|
| | 1,6-Bis(triethoxysilyl)hexane Basic information |
| Product Name: | 1,6-Bis(triethoxysilyl)hexane | | Synonyms: | 1,6-Bis(triethoxysilyl)hexane;3,12-Dioxa-4,11-disilatetradecane, 4,4,11,11-tetraethoxy-;triethoxy(6-triethoxysilylhexyl)silane;4,4,11,11-Tetraethoxy-3,12-dioxa-4,11-disilatetradecane;riethoxy(6-triethoxysilylhexyl)silane;DK319 | | CAS: | 52034-16-9 | | MF: | C18H42O6Si2 | | MW: | 410.69 | | EINECS: | | | Product Categories: | | | Mol File: | 52034-16-9.mol |  |
| | 1,6-Bis(triethoxysilyl)hexane Chemical Properties |
| Boiling point | 115 °C/0.05 mmHg | | refractive index | 1.42 | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C18H42O6Si2/c1-7-19-25(20-8-2,21-9-3)17-15-13-14-16-18-26(22-10-4,23-11-5)24-12-6/h7-18H2,1-6H3 | | InChIKey | NRYWFNLVRORSCA-UHFFFAOYSA-N | | SMILES | CCO[Si](OCC)(OCC)CCCCCC[Si](OCC)(OCC)OCC | | CAS DataBase Reference | 52034-16-9 |
| | 1,6-Bis(triethoxysilyl)hexane Usage And Synthesis |
| | 1,6-Bis(triethoxysilyl)hexane Preparation Products And Raw materials |
|