|
|
| | ethyl 5-aMino-2-chloropyriMidine-4-carboxylate Basic information |
| | ethyl 5-aMino-2-chloropyriMidine-4-carboxylate Chemical Properties |
| Melting point | 155 °C | | Boiling point | 376.8±22.0 °C(Predicted) | | density | 1.395±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | -2.13±0.10(Predicted) | | Appearance | Light yellow to orange Solid | | InChI | InChI=1S/C7H8ClN3O2/c1-2-13-6(12)5-4(9)3-10-7(8)11-5/h3H,2,9H2,1H3 | | InChIKey | BNFCEIMRFKQNND-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(N)C(C(OCC)=O)=N1 |
| | ethyl 5-aMino-2-chloropyriMidine-4-carboxylate Usage And Synthesis |
| Synthesis |
Ethyl 2,6-Dichloro-5-nitropyrimidine-4-carboxylate could be used to synthesis ethyl 5-aMino-2-chloropyriMidine-4-carboxylate.
|
| | ethyl 5-aMino-2-chloropyriMidine-4-carboxylate Preparation Products And Raw materials |
|