|
|
| | Luteolin-3'-D-glucuronide Basic information |
| Product Name: | Luteolin-3'-D-glucuronide | | Synonyms: | Luteolin-3'-D-glucuronide;Luteolin 3'-O-beta-D-glucuronide;Luteolin 3'-O-glucuronide;Luteolin-3-O-β-D-glucuronide;β-D-Glucopyranosiduronic acid, 5-(5,7-dihydroxy-4-oxo-4H-1-benzopyran-2-yl)-2-hydroxyphenyl;Luteolin 3 O beta D glucuronide,Luteolin3ObetaDglucuronide,Inhibitor,inhibit;(2S,3S,4S,5R,6S)-6-(5-(5,7-Dihydroxy-4-oxo-4H-chromen-2-yl)-2-hydroxyphenoxy)-3,4,5-trihydroxytetrahydro-2H-pyran-2-carboxylic acid;Luteolin 3'-glucuronide | | CAS: | 53527-42-7 | | MF: | C21H18O12 | | MW: | 462.36 | | EINECS: | | | Product Categories: | | | Mol File: | 53527-42-7.mol |  |
| | Luteolin-3'-D-glucuronide Chemical Properties |
| Boiling point | 865.4±65.0 °C(Predicted) | | density | 1.810±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in DMSO and methanol; | | form | powder | | pka | 2.79±0.70(Predicted) | | color | Yellow | | Water Solubility | insoluble in water | | InChIKey | JDOFZOKGCYYUER-ZFORQUDYSA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1C(=O)O)O)O)O)Oc2c(ccc(c2)c3[o]c4c([c](c3)=O)c(cc(c4)O)O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Luteolin-3'-D-glucuronide Usage And Synthesis |
| Uses | Luteolin 3''-O-glucuronide is a strong antioxidant as a food additive. Potential acetylcholinesterase activity. | | Definition | ChEBI: Luteolin 3'-O-glucuronide is a luteolin glucosiduronic acid consisting of luteolin having a beta-D-glucosiduronic acid residue attached at the 3'-position. It has a role as a metabolite. It is a luteolin O-glucuronoside and a trihydroxyflavone. | | target | NO |
| | Luteolin-3'-D-glucuronide Preparation Products And Raw materials |
|