|
|
| | Bis(benzonitrile)dichloroplatinum(II) Basic information |
| | Bis(benzonitrile)dichloroplatinum(II) Chemical Properties |
| Melting point | 224 °C (dec.)(lit.) | | InChI | InChI=1S/2C7H5N.2ClH.Pt/c2*8-6-7-4-2-1-3-5-7;;;/h2*1-5H;2*1H;/q;;;;+2/p-2 | | InChIKey | WAJRCRIROYMRKA-UHFFFAOYSA-L | | SMILES | C(C1C=CC=CC=1)#[N][Pt+2]([Cl-])([Cl-])[N]#CC1C=CC=CC=1 | | CAS DataBase Reference | 15617-19-3 |
| Hazard Codes | T | | WGK Germany | 3 | | RTECS | TP2185000 | | Storage Class | 11 - Combustible Solids |
| | Bis(benzonitrile)dichloroplatinum(II) Usage And Synthesis |
| Chemical Properties | Pale yellow micro-crystals | | Uses | Catalyst for: Asymmetric hydroformylation reactions Allylation reactions Carbene insertion into O-H bonds of alcohols Cyclopropanation reactions Hydrosilylation reacttions | | Uses | Catalyst for:
- Asymmetric hydroformylation reactions
- Allylation reactions
- Carbene insertion into O-H bonds of alcohols
- Cyclopropanation reactions
- Hydrosilylation reactions
| | reaction suitability | core: platinum reagent type: catalyst |
| | Bis(benzonitrile)dichloroplatinum(II) Preparation Products And Raw materials |
|