|
|
| | 1-(4-AMINO-3-CHLORO-PHENYL)-ETHANONE Basic information |
| | 1-(4-AMINO-3-CHLORO-PHENYL)-ETHANONE Chemical Properties |
| Boiling point | 324.6±27.0 °C(Predicted) | | density | 1.254±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 0.22±0.10(Predicted) | | form | Solid | | color | Pale Yellow to Light Beige | | InChI | InChI=1S/C8H8ClNO/c1-5(11)6-2-3-8(10)7(9)4-6/h2-4H,10H2,1H3 | | InChIKey | VGVXDPRCTIRHOO-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(N)C(Cl)=C1)C |
| | 1-(4-AMINO-3-CHLORO-PHENYL)-ETHANONE Usage And Synthesis |
| Uses | 1-(4-Amino-3-chlorophenyl)ethanone is an intermediate to many COX-II selective inhibitors. |
| | 1-(4-AMINO-3-CHLORO-PHENYL)-ETHANONE Preparation Products And Raw materials |
|