|
|
| | Tri(propylene glycol) diacrylate Basic information |
| Product Name: | Tri(propylene glycol) diacrylate | | Synonyms: | 2-propenoicacid,(1-methyl-1,2-ethanediyl)bis(oxy(methyl-2,1-ethanediyl))es;2-Propenoicacid,(1-methyl-1,2-ethanediyl)bis[oxy(methyl-2,1-ethanediyl)]ester;Photomer 4061;Tri(propylene glycol) diacrylate(TPGDA、TRPGDA);acrylicacid,propylenebis(oxypropylene)ester;TRI(PROPYLENE GLYCOL) DIACRYLATE, TECH., MIXTURE OF ISOMERS;tri(propylene glycol) diacrylate, mixture of isomers;Tripropylenglykoldiacrylat | | CAS: | 42978-66-5 | | MF: | C15H24O6 | | MW: | 300.35 | | EINECS: | 256-032-2 | | Product Categories: | Functional Monomer;Diacrylates & Dimethacrylates;Functional Materials;Reagent for High-Performance Polymer Research;42978-66-5 | | Mol File: | 42978-66-5.mol |  |
| | Tri(propylene glycol) diacrylate Chemical Properties |
| Boiling point | 361.58°C (rough estimate) | | density | 1.03 g/mL at 25 °C(lit.) | | vapor density | >1 (vs air) | | vapor pressure | <0.01 mm Hg ( 20 °C) | | refractive index | n20/D 1.45(lit.) | | Fp | >230 °F | | storage temp. | Amber Vial, Refrigerator, Under inert atmosphere | | solubility | Chloroform, Methanol (Slightly) | | form | Oil | | color | Colourless | | Water Solubility | 4g/L at 20℃ | | Stability: | Light Sensitive | | Cosmetics Ingredients Functions | PLASTICISER
NAIL CONDITIONING | | InChI | 1S/C15H24O6/c1-6-14(16)20-12(4)9-18-8-11(3)19-10-13(5)21-15(17)7-2/h6-7,11-13H,1-2,8-10H2,3-5H3 | | InChIKey | LJRSZGKUUZPHEB-UHFFFAOYSA-N | | SMILES | CC(COC(C)COC(=O)C=C)OCC(C)OC(=O)C=C | | CAS DataBase Reference | 42978-66-5(CAS DataBase Reference) | | EPA Substance Registry System | Tripropylene glycol diacrylate (42978-66-5) |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-43-51/53 | | Safety Statements | 24-37-61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 2 | | RTECS | AT4690000 | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29161290 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 2
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | Tri(propylene glycol) diacrylate Usage And Synthesis |
| Description | As a cause of occupational contact dermatitis, tripropylene
glycol diacrylate (TPGDA) was contained in
dental resins, in UV-cured inks and in nail eosmetics. | | Uses | Tripropylene Glycol Diacrylate is a microparticle used to study continuous-flow lithography of high-throughput microparticle synthesis. | | Uses | Tripropylene glycol diacrylate is a diacrylate monomer for use in UV-curable flexographic and silk-screen inks, wood-finish varnishes, coatings on plastics, etc. | | Flammability and Explosibility | Non flammable | | Toxics Screening Level | The initial threshold screening level (ITSL) for tripropylene glycol diacrylate (TPGD) is 22 μg/m3 based on an annual averaging time. |
| | Tri(propylene glycol) diacrylate Preparation Products And Raw materials |
|