| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:Iguratimod Impurity 10
CAS:149456-97-3
Purity:對(duì)照品 Package:10mg~500mg Remarks:AC001208010
|
| Company Name: |
S.Z. PhyStandard Bio-Tech. Co., Ltd.
|
| Tel: |
0755-4000505016 13380397412 |
| Email: |
3001272453@qq.com |
| Products Intro: |
Product Name:Iguratimod Impurity 14
CAS:149456-97-3
Purity:98%HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Iguratimod Impurity 18
CAS:149456-97-3
Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:Iguratimod Impurity 10
CAS:149456-97-3
Package:100mg Remarks:V25303
|
|
| | Iguratimod Impurity 10 Basic information |
| Product Name: | Iguratimod Impurity 10 | | Synonyms: | Iguratimod Impurity 10;Acetamide, N-[2-[2-methoxy-4-[(methylsulfonyl)amino]-5-phenoxyphenyl]-2-oxoethyl]-;Eramod Impurity 8;N-(2-(2-Methoxy-4-(methylsulfonamido)-5-phenoxyphenyl)-2-oxoethyl)acetamide (Iguratimod Impurity);N-[2-[2-Methoxy-4-[(methylsulfonyl)amino]-5-phenoxyphenyl]-2-oxoethyl]acetamide | | CAS: | 149456-97-3 | | MF: | C18H20N2O6S | | MW: | 392.43 | | EINECS: | | | Product Categories: | | | Mol File: | 149456-97-3.mol |  |
| | Iguratimod Impurity 10 Chemical Properties |
| density | 1.330±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 6.54±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C18H20N2O6S/c1-12(21)19-11-16(22)14-9-18(26-13-7-5-4-6-8-13)15(10-17(14)25-2)20-27(3,23)24/h4-10,20H,11H2,1-3H3,(H,19,21) | | InChIKey | FQESIYQBZDVKNU-UHFFFAOYSA-N | | SMILES | C(NCC(C1=CC(OC2=CC=CC=C2)=C(NS(C)(=O)=O)C=C1OC)=O)(=O)C |
| | Iguratimod Impurity 10 Usage And Synthesis |
| | Iguratimod Impurity 10 Preparation Products And Raw materials |
|