|
|
| | 6-Methoxypyridine-2-carbaldehyde Basic information |
| Product Name: | 6-Methoxypyridine-2-carbaldehyde | | Synonyms: | 2-Formyl-6-methoxypyridine ,97%;6-Methoxy-2-pyridinecarbaldehyde;6-Methoxypyridine-2-carboxaldehyde, 96%;6-Methoxy-2-pyridinecarboxaldehyde,2-Formyl-6-methoxypyridine, 6-Methoxypyridine-2-carbaldehyde;2-Formyl-6-methoxypyridine, 6-Methoxypicolinaldehyde;Methoxy-6-pyridinecarboxaldeh;6-Methoxy-2-pyridinecarboxaldehyde 97%;2-FORMYL-6-METHOXYPYRIDINE | | CAS: | 54221-96-4 | | MF: | C7H7NO2 | | MW: | 137.14 | | EINECS: | | | Product Categories: | Heterocycle-Pyridine series | | Mol File: | 54221-96-4.mol |  |
| | 6-Methoxypyridine-2-carbaldehyde Chemical Properties |
| Boiling point | 103-104 ºC (20 MMHG) | | density | 1.140 | | refractive index | 1.532 | | Fp | 81 ºC | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | pka | 2.44±0.10(Predicted) | | color | Colorless to Light yellow | | Sensitive | Air Sensitive | | InChI | InChI=1S/C7H7NO2/c1-10-7-4-2-3-6(5-9)8-7/h2-5H,1H3 | | InChIKey | YDNWTNODZDSPNZ-UHFFFAOYSA-N | | SMILES | C1(C=O)=NC(OC)=CC=C1 | | CAS DataBase Reference | 54221-96-4(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38-43 | | Safety Statements | 26-36/37/39 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | HS Code | 29333990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 STOT SE 3 |
| | 6-Methoxypyridine-2-carbaldehyde Usage And Synthesis |
| Uses | Synthesis of the corresponding α-pyridoin via treatment with NaCN. |
| | 6-Methoxypyridine-2-carbaldehyde Preparation Products And Raw materials |
|