|
|
| | Tetrabutylammonium cyanoborohydride Basic information |
| Product Name: | Tetrabutylammonium cyanoborohydride | | Synonyms: | TETRABUTYLAMMONIUM CYANOBOROHYDRIDE;TETRABUTYLAMMONIUM CYANOTRIHYDROBORATE;tetrabutylammonium (cyano-C)trihydroborate;1-Butanaminium, N,N,N-tributyl-, (T-4)-(cyano-C)trihydroborate(1-);Cyano-trihydrido-boron tetrabutylazanium;Tetrabutylammonium cyanoborohydride,95%;Tetrabutylammonium cyanoborohydride,98%;Tetra-n-butylammonium Cyanoborohydride | | CAS: | 43064-96-6 | | MF: | C17H39BN2 | | MW: | 282.32 | | EINECS: | 256-073-6 | | Product Categories: | Borohydrides;Reduction;Synthetic Reagents | | Mol File: | 43064-96-6.mol |  |
| | Tetrabutylammonium cyanoborohydride Chemical Properties |
| Melting point | 144-146 °C(lit.) | | storage temp. | water-free area | | solubility | sol most polar (e.g. alcohols, carboxylic acids), polar aprotic (e.g. HMPA, DMSO, DMF), and nonpolar (e.g. CH2Cl2, benzene, hexane) solvents; sparingly sol H2O, ether. | | form | nonhydroscopic solid | | color | white | | InChI | 1S/C16H36N.CH3BN/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1-3/h5-16H2,1-4H3;2H3/q+1;-1 | | InChIKey | BOHYACMUNXBTGV-UHFFFAOYSA-N | | SMILES | [BH3-]C#N.CCCC[N+](CCCC)(CCCC)CCCC | | CAS DataBase Reference | 43064-96-6 |
| Hazard Codes | Xi,F | | Risk Statements | 36/37/38-15 | | Safety Statements | 26-36-7/8-37/39 | | WGK Germany | 3 | | F | 21 | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Tetrabutylammonium cyanoborohydride Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | Reactant for:
- Hydroxymethylation reactions
- Radical carbonylation reactions
- Reduction reactions (reductant)
| | Uses | Tetrabutylammonium Cyanoborohydride is used in preparation method of novel biomass plastic material. | | Application |
Tetrabutylammonium cyanoborohydride (TBAC) is used as a selective, mild reducing reagent for aldehydes, conjugated aldehydes and ketones, alkyl iodides and bromides; useful for reductive
aminations of aldehydes and ketones in nonpolar solvents.
| | Preparation | Tetrabutylammonium cyanoborohydride is prepared from n-Bu4NHSO4 suspended in H2O, treated with Sodium Hydroxide and Sodium Cyanoborohydride, and
extracted into CH2Cl2; recrystallized from ethyl acetate. Other tetraalkylammonium derivatives are available (including polymersupported) or can be generated in situ from NaBH3CN and Aliquat 336. | | reaction suitability | reagent type: reductant |
| | Tetrabutylammonium cyanoborohydride Preparation Products And Raw materials |
|