| Company Name: |
Shanghai Lingfu Pharmaceutical Research Co. LTD Gold
|
| Tel: |
+86(21)5895 0110 19945755304 |
| Email: |
sales@chemany.com |
| Products Intro: |
Product Name:(3S)-3-(4-bromophenyl)piperidine; 4-methylbenzene-1-sulfonic acid CAS:1476776-53-0 Purity:95%+ Package:5g;25g;100g
|
| Company Name: |
LinkChem Technology Co., Ltd.
|
| Tel: |
021-58950110 13124863828 |
| Email: |
sales@linkchem.cn |
| Products Intro: |
Product Name:Piperidine, 3-(4-bromophenyl)-, (3S)-, 4-methylbenzenesulfonate (1:1) CAS:1476776-53-0 Purity:95%+ Package:1g
|
|
| | Piperidine, 3-(4-bromophenyl)-, (3S)-, 4-methylbenzenesulfonate (1:1) Basic information |
| | Piperidine, 3-(4-bromophenyl)-, (3S)-, 4-methylbenzenesulfonate (1:1) Chemical Properties |
| Melting point | 156 °C | | InChI | InChI=1S/C11H14BrN.C7H8O3S/c12-11-5-3-9(4-6-11)10-2-1-7-13-8-10;1-6-2-4-7(5-3-6)11(8,9)10/h3-6,10,13H,1-2,7-8H2;2-5H,1H3,(H,8,9,10)/t10-;/m1./s1 | | InChIKey | PPQAJBREQCMMIB-HNCPQSOCSA-N | | SMILES | N1CCC[C@@H](C2=CC=C(Br)C=C2)C1.C1(S(O)(=O)=O)=CC=C(C)C=C1 |
| | Piperidine, 3-(4-bromophenyl)-, (3S)-, 4-methylbenzenesulfonate (1:1) Usage And Synthesis |
| | Piperidine, 3-(4-bromophenyl)-, (3S)-, 4-methylbenzenesulfonate (1:1) Preparation Products And Raw materials |
|