- Alovudine
-
- $33.00
-
2026-05-11
- CAS:25526-93-6
- Purity: 99.69%
- Supply Ability: 10g
|
| | 3'-Deoxy-3'-fluorothymidine Basic information |
| | 3'-Deoxy-3'-fluorothymidine Chemical Properties |
| Melting point | 176-178 °C(lit.) | | density | 1.2866 (estimate) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | buffered aqueous solution | | pka | 9.55±0.10(Predicted) | | color | White to Beige | | biological source | rabbit | | Stability: | Hygroscopic | | InChI | InChI=1S/C10H13FN2O4/c1-5-3-13(10(16)12-9(5)15)8-2-6(11)7(4-14)17-8/h3,6-8,14H,2,4H2,1H3,(H,12,15,16)/t6-,7+,8+/m0/s1 | | InChIKey | UXCAQJAQSWSNPQ-XLPZGREQSA-N | | SMILES | O=C1NC(C(=CN1[C@H]1C[C@@H]([C@H](O1)CO)F)C)=O | | CAS DataBase Reference | 25526-93-6 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | XP2073000 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 3'-Deoxy-3'-fluorothymidine Usage And Synthesis |
| Chemical Properties | Colourless solid | | Uses | An antiviral agent | | Uses | Promising antiviral agent possessing activity similar to other 3′-deoxy-3′-substituted thymidines. | | Definition | ChEBI: Alovudine is a pyrimidine 2',3'-dideoxyribonucleoside. |
| | 3'-Deoxy-3'-fluorothymidine Preparation Products And Raw materials |
|