|
|
| | p-phenylenebis(trimellitate anhydride)) Basic information |
| Product Name: | p-phenylenebis(trimellitate anhydride)) | | Synonyms: | p-phenylenebis(trimellitate anhydride));p-Phenylene bis(trimellitate) dianhydride; p-Phenylene bis(trimellitate) dianhydride,TAHQ;P-PHENYLENEBIS (TRIMELLITATE ANHYDRIDE) (TAHQ);1,4-Phenylene Bis(1,3-dioxo-1,3-dihydroisobenzof uran-5-carboxylate) (TAHQ);5-Isobenzofurancarboxylic acid, 1,3-dihydro-1,3-dioxo-, 5,5'-(1,4-phenylene) ester;Bis(1,3-dioxo-1,3-dihydroisobenzofuran-5-carboxylic Acid) 1,4-Phenylene Ester;1,4-Phenylene Bis(anhydrotrimellitate) | | CAS: | 2770-49-2 | | MF: | C24H10O10 | | MW: | 458.33 | | EINECS: | | | Product Categories: | PI | | Mol File: | 2770-49-2.mol |  |
| | p-phenylenebis(trimellitate anhydride)) Chemical Properties |
| Melting point | 255 °C | | Boiling point | 757.9±55.0 °C(Predicted) | | density | 1.622±0.06 g/cm3(Predicted) | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C24H10O10/c25-19(11-1-7-15-17(9-11)23(29)33-21(15)27)31-13-3-5-14(6-4-13)32-20(26)12-2-8-16-18(10-12)24(30)34-22(16)28/h1-10H | | InChIKey | CXISKMDTEFIGTG-UHFFFAOYSA-N | | SMILES | C1(OC(C2C=CC3C(=O)OC(=O)C=3C=2)=O)=CC=C(OC(C2C=CC3C(=O)OC(=O)C=3C=2)=O)C=C1 | | CAS DataBase Reference | 2770-49-2 |
| | p-phenylenebis(trimellitate anhydride)) Usage And Synthesis |
| Uses | 1,4-Phenylene Bis(anhydrotrimellitate) is a useful reagent in the synthesis of soluble biopolyimides using 4-aminophenylalanine. | | Uses | P-phenylenebis(trimellitate anhydride) is an organic anhydride and can be used as medical intermediates. |
| | p-phenylenebis(trimellitate anhydride)) Preparation Products And Raw materials |
|