|
|
| | 1,2,4,5-benzene tetracarboxalaldehyde Basic information |
| Product Name: | 1,2,4,5-benzene tetracarboxalaldehyde | | Synonyms: | 1,2,4,5-benzene tetracarboxalaldehyde;1,2,4,5-Benzenetetracarboxaldehyde;benzene-1,2,4,5-tetracarbaldehyde;1,2,4,5-phenylenetetraaldehyde;1,2,4,5-Tetraformylbenzol | | CAS: | 14674-89-6 | | MF: | C10H6O4 | | MW: | 190.15 | | EINECS: | | | Product Categories: | | | Mol File: | 14674-89-6.mol |  |
| | 1,2,4,5-benzene tetracarboxalaldehyde Chemical Properties |
| Melting point | 167-175 °C | | Boiling point | 451.9±45.0 °C(Predicted) | | density | 1.397±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C10H6O4/c11-3-7-1-8(4-12)10(6-14)2-9(7)5-13/h1-6H | | InChIKey | WSENOXLTIIJHKE-UHFFFAOYSA-N | | SMILES | C1(C=O)=CC(C=O)=C(C=O)C=C1C=O |
| | 1,2,4,5-benzene tetracarboxalaldehyde Usage And Synthesis |
| Uses | 1,2,4,5-Benzenetetracarboxaldehyde is a useful building block for organic synthesis. |
| | 1,2,4,5-benzene tetracarboxalaldehyde Preparation Products And Raw materials |
|